About 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine
7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine (PubChem CID 118247734) has the molecular formula C18H21Cl2N5S
and a molecular weight of 410.37 g/mol. Its IUPAC name is 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine.
Molecular Properties
| Compound Name | 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine |
| PubChem CID | 118247734 |
| Molecular Formula | C18H21Cl2N5S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine |
| SMILES | Nc1nc(N2CCC3(CCC3N)CC2)cnc1Sc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H21Cl2N5S/c19-11-2-1-3-12(15(11)20)26-17-16(22)24-14(10-23-17)25-8-6-18(7-9-25)5-4-13(18)21/h1-3,10,13H,4-9,21H2,(H2,22,24) |
| InChIKey | QBGAGJLZTQGJON-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine?
The IUPAC name of 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine (CID 118247734) is 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine.
What is the SMILES notation for 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine?
The canonical SMILES for 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine is Nc1nc(N2CCC3(CCC3N)CC2)cnc1Sc1cccc(Cl)c1Cl.
What is the InChIKey of 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine?
The InChIKey is QBGAGJLZTQGJON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2N5S/c19-11-2-1-3-12(15(11)20)26-17-16(22)24-14(10-23-17)25-8-6-18(7-9-25)5-4-13(18)21/h1-3,10,13H,4-9,21H2,(H2,22,24).
What are the key properties of 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine?
7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine has a molecular weight of 410.37 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[6-amino-5-(2,3-dichlorophenyl)sulfanylpyrazin-2-yl]-7-azaspiro[3.5]nonan-3-amine is sourced from PubChem (CID 118247734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).