About 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate
1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118247801) has the molecular formula C14H10Cl2F3NO4
and a molecular weight of 384.14 g/mol. Its IUPAC name is 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| PubChem CID | 118247801 |
| Molecular Formula | C14H10Cl2F3NO4 |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | C=NOC(C)OC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C14H10Cl2F3NO4/c1-6(24-20-2)22-13(21)9-4-7-3-8(15)5-10(16)11(7)23-12(9)14(17,18)19/h3-6,12H,2H2,1H3/t6?,12-/m0/s1 |
| InChIKey | HZJBSSDDYGMWMK-ZZUHDNHVSA-N |
| XLogP | 4.22 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The IUPAC name of 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (CID 118247801) is 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
What is the SMILES notation for 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The canonical SMILES for 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate is C=NOC(C)OC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F.
What is the InChIKey of 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The InChIKey is HZJBSSDDYGMWMK-ZZUHDNHVSA-N. The full InChI is InChI=1S/C14H10Cl2F3NO4/c1-6(24-20-2)22-13(21)9-4-7-3-8(15)5-10(16)11(7)23-12(9)14(17,18)19/h3-6,12H,2H2,1H3/t6?,12-/m0/s1.
What are the key properties of 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate has a molecular weight of 384.14 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylideneamino)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate is sourced from PubChem (CID 118247801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).