C12H18Br2O3 — CID 11824805
2-[(1S,2S,4R)-5,6-dibromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol (PubChem CID 11824805) has the molecular formula C12H18Br2O3 and a molecular weight of 370.08 g/mol. Its IUPAC name is 2-[(1S,2S,4R)-5,6-dibromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol.
| Compound Name | 2-[(1S,2S,4R)-5,6-dibromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol |
|---|---|
| PubChem CID | 11824805 |
| Molecular Formula | C12H18Br2O3 |
| Molecular Weight | 370.08 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 2-[(1S,2S,4R)-5,6-dibromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-2-ol |
| SMILES | COC1(OC)[C@H]2C[C@H](C(C)(C)O)[C@@H]1C(Br)=C2Br |
| InChI | InChI=1S/C12H18Br2O3/c1-11(2,15)6-5-7-9(13)10(14)8(6)12(7,16-3)17-4/h6-8,15H,5H2,1-4H3/t6-,7-,8+/m0/s1 |
| InChIKey | IQINRFYKYQCVNG-BIIVOSGPSA-N |
| XLogP | 3.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.08 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|