About 5-butoxy-3-fluoroazepane
5-butoxy-3-fluoroazepane (PubChem CID 118248055) has the molecular formula C10H20FNO
and a molecular weight of 189.27 g/mol. Its IUPAC name is 5-butoxy-3-fluoroazepane.
Molecular Properties
| Compound Name | 5-butoxy-3-fluoroazepane |
| PubChem CID | 118248055 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 5-butoxy-3-fluoroazepane |
| SMILES | CCCCOC1CCNCC(F)C1 |
| InChI | InChI=1S/C10H20FNO/c1-2-3-6-13-10-4-5-12-8-9(11)7-10/h9-10,12H,2-8H2,1H3 |
| InChIKey | USUJSTFVFMLTHS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-3-fluoroazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-3-fluoroazepane?
The IUPAC name of 5-butoxy-3-fluoroazepane (CID 118248055) is 5-butoxy-3-fluoroazepane.
What is the SMILES notation for 5-butoxy-3-fluoroazepane?
The canonical SMILES for 5-butoxy-3-fluoroazepane is CCCCOC1CCNCC(F)C1.
What is the InChIKey of 5-butoxy-3-fluoroazepane?
The InChIKey is USUJSTFVFMLTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20FNO/c1-2-3-6-13-10-4-5-12-8-9(11)7-10/h9-10,12H,2-8H2,1H3.
What are the key properties of 5-butoxy-3-fluoroazepane?
5-butoxy-3-fluoroazepane has a molecular weight of 189.27 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-3-fluoroazepane is sourced from PubChem (CID 118248055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).