C24H26N2O4 — CID 118248240
6,7-dimethyl-9-(3,4,5-trimethoxyanilino)-3,4-dihydro-2H-acridin-1-one (PubChem CID 118248240) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 6,7-dimethyl-9-(3,4,5-trimethoxyanilino)-3,4-dihydro-2H-acridin-1-one.
| Compound Name | 6,7-dimethyl-9-(3,4,5-trimethoxyanilino)-3,4-dihydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 118248240 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 6,7-dimethyl-9-(3,4,5-trimethoxyanilino)-3,4-dihydro-2H-acridin-1-one |
| SMILES | COc1cc(Nc2c3c(nc4cc(C)c(C)cc24)CCCC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N2O4/c1-13-9-16-18(10-14(13)2)26-17-7-6-8-19(27)22(17)23(16)25-15-11-20(28-3)24(30-5)21(12-15)29-4/h9-12H,6-8H2,1-5H3,(H,25,26) |
| InChIKey | XPDGBTOOLAXLJW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |