C9H11F2N3 — CID 118248765
(3Z,5E)-5-(2-azido-1,1-difluoroethyl)hepta-1,3,5-triene (PubChem CID 118248765) has the molecular formula C9H11F2N3 and a molecular weight of 199.20 g/mol. Its IUPAC name is (3Z,5E)-5-(2-azido-1,1-difluoroethyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-(2-azido-1,1-difluoroethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 118248765 |
| Molecular Formula | C9H11F2N3 |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | (3Z,5E)-5-(2-azido-1,1-difluoroethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)C(F)(F)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H11F2N3/c1-3-5-6-8(4-2)9(10,11)7-13-14-12/h3-6H,1,7H2,2H3/b6-5-,8-4+ |
| InChIKey | PLASRWSVCWLSCO-QNMAEOQASA-N |
| XLogP | 3.62 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|