2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid

C10H9N3O3 — CID 118249151

IUPAC2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid
SMILESCc1ccnc(Nc2ncc(C(=O)O)o2)c1
InChIInChI=1S/C10H9N3O3/c1-6-2-3-11-8(4-6)13-10-12-5-7(16-10)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)
InChIKeyDOBDXKLWTYTEEA-UHFFFAOYSA-N
MW219.20 g/mol
LogP1.82
Rot. Bonds3

About 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid

2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid (PubChem CID 118249151) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid
PubChem CID118249151
Molecular FormulaC10H9N3O3
Molecular Weight219.20 g/mol
Exact Mass219.06
IUPAC Name2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid
SMILESCc1ccnc(Nc2ncc(C(=O)O)o2)c1
InChIInChI=1S/C10H9N3O3/c1-6-2-3-11-8(4-6)13-10-12-5-7(16-10)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)
InChIKeyDOBDXKLWTYTEEA-UHFFFAOYSA-N
XLogP1.82
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 51.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid (CID 118249151) is 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid is Cc1ccnc(Nc2ncc(C(=O)O)o2)c1.
What is the InChIKey of 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid?
The InChIKey is DOBDXKLWTYTEEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c1-6-2-3-11-8(4-6)13-10-12-5-7(16-10)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13).
What are the key properties of 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid?
2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid has a molecular weight of 219.20 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-2-pyridinyl)amino]-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 118249151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).