C18H22Cl2N2O4S — CID 118249519
(1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(2-hydroxyethyl)-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 118249519) has the molecular formula C18H22Cl2N2O4S and a molecular weight of 433.36 g/mol. Its IUPAC name is (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(2-hydroxyethyl)-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(2-hydroxyethyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 118249519 |
| Molecular Formula | C18H22Cl2N2O4S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(2-hydroxyethyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | C=C[C@@H]1CN(CCO)C(=O)[C@@H]2CCC[C@H]1N2S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N2O4S/c1-2-12-11-21(6-7-23)18(24)17-5-3-4-16(12)22(17)27(25,26)15-9-13(19)8-14(20)10-15/h2,8-10,12,16-17,23H,1,3-7,11H2/t12-,16-,17+/m1/s1 |
| InChIKey | MRMVSIDRAANJBH-JLZZUVOBSA-N |
| XLogP | 2.54 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|