C20H28Cl2N2O5S — CID 118249531
(1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-(hydroxymethyl)-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 118249531) has the molecular formula C20H28Cl2N2O5S and a molecular weight of 479.43 g/mol. Its IUPAC name is (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-(hydroxymethyl)-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-(hydroxymethyl)-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 118249531 |
| Molecular Formula | C20H28Cl2N2O5S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-(hydroxymethyl)-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | COCCCCN1C[C@@H](CO)[C@H]2CCC[C@@H](C1=O)N2S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H28Cl2N2O5S/c1-29-8-3-2-7-23-12-14(13-25)18-5-4-6-19(20(23)26)24(18)30(27,28)17-10-15(21)9-16(22)11-17/h9-11,14,18-19,25H,2-8,12-13H2,1H3/t14-,18+,19-/m0/s1 |
| InChIKey | CVAWDJUQRMDYKM-KYNGSXCRSA-N |
| XLogP | 2.78 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|