C21H28Cl2N2O4S — CID 118249541
(1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 118249541) has the molecular formula C21H28Cl2N2O4S and a molecular weight of 475.44 g/mol. Its IUPAC name is (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 118249541 |
| Molecular Formula | C21H28Cl2N2O4S |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (1S,5R,6R)-10-(3,5-dichlorophenyl)sulfonyl-5-ethenyl-3-(4-methoxybutyl)-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | C=C[C@@H]1CN(CCCCOC)C(=O)[C@@H]2CCC[C@H]1N2S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H28Cl2N2O4S/c1-3-15-14-24(9-4-5-10-29-2)21(26)20-8-6-7-19(15)25(20)30(27,28)18-12-16(22)11-17(23)13-18/h3,11-13,15,19-20H,1,4-10,14H2,2H3/t15-,19-,20+/m1/s1 |
| InChIKey | XJBRLUPUTIHELW-YSGRDPCXSA-N |
| XLogP | 3.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|