C26H32Cl2N2O7S — CID 118249590
(1S,5S,6R)-1,4,4,5,6,7-hexadeuterio-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-[(1R)-1-hydroxyethyl]-3,10-diazabicyclo[4.3.1]decan-2-one (PubChem CID 118249590) has the molecular formula C26H32Cl2N2O7S and a molecular weight of 593.56 g/mol. Its IUPAC name is (1S,5S,6R)-1,4,4,5,6,7-hexadeuterio-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-[(1R)-1-hydroxyethyl]-3,10-diazabicyclo[4.3.1]decan-2-one.
| Compound Name | (1S,5S,6R)-1,4,4,5,6,7-hexadeuterio-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-[(1R)-1-hydroxyethyl]-3,10-diazabicyclo[4.3.1]decan-2-one |
|---|---|
| PubChem CID | 118249590 |
| Molecular Formula | C26H32Cl2N2O7S |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | (1S,5S,6R)-1,4,4,5,6,7-hexadeuterio-10-(3,5-dichlorophenyl)sulfonyl-3-[2-(3,4-dimethoxyphenoxy)ethyl]-5-[(1R)-1-hydroxyethyl]-3,10-diazabicyclo[4.3.1]decan-2-one |
| SMILES | [2H]C1CC[C@@]2([2H])C(=O)N(CCOc3ccc(OC)c(OC)c3)C([2H])([2H])[C@]([2H])([C@@H](C)O)[C@]1([2H])N2S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H32Cl2N2O7S/c1-16(31)21-15-29(9-10-37-19-7-8-24(35-2)25(14-19)36-3)26(32)23-6-4-5-22(21)30(23)38(33,34)20-12-17(27)11-18(28)13-20/h7-8,11-14,16,21-23,31H,4-6,9-10,15H2,1-3H3/t16-,21-,22-,23+/m1/s1/i5D,15D2,21D,22D,23D/t5?,16-,21-,22-,23+ |
| InChIKey | BHOWDWVJBOKPPI-TYRFUECMSA-N |
| XLogP | 3.84 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |