About [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate
[1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate (PubChem CID 118249916) has the molecular formula C20H26ClN3O3
and a molecular weight of 391.90 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate.
Molecular Properties
| Compound Name | [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate |
| PubChem CID | 118249916 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate |
| SMILES | CC(C)(C)c1cc(NC(=O)OC2CCCN(Cc3ccc(Cl)cc3)C2)no1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-20(2,3)17-11-18(23-27-17)22-19(25)26-16-5-4-10-24(13-16)12-14-6-8-15(21)9-7-14/h6-9,11,16H,4-5,10,12-13H2,1-3H3,(H,22,23,25) |
| InChIKey | UKVIPSGUUWGOBC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate?
The IUPAC name of [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate (CID 118249916) is [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate.
What is the SMILES notation for [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate?
The canonical SMILES for [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate is CC(C)(C)c1cc(NC(=O)OC2CCCN(Cc3ccc(Cl)cc3)C2)no1.
What is the InChIKey of [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate?
The InChIKey is UKVIPSGUUWGOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26ClN3O3/c1-20(2,3)17-11-18(23-27-17)22-19(25)26-16-5-4-10-24(13-16)12-14-6-8-15(21)9-7-14/h6-9,11,16H,4-5,10,12-13H2,1-3H3,(H,22,23,25).
What are the key properties of [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate?
[1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate has a molecular weight of 391.90 g/mol, XLogP of 4.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-chlorophenyl)methyl]piperidin-3-yl] N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate is sourced from PubChem (CID 118249916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).