C15H17Cl4N5 — CID 118250312
N-[4-(3-chlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 118250312) has the molecular formula C15H17Cl4N5 and a molecular weight of 409.15 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[4-(3-chlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 118250312 |
| Molecular Formula | C15H17Cl4N5 |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-[4-(3-chlorophenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2cccc(Cl)c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C15H17Cl4N5/c1-24(2)8-4-7-20-14-22-12(10-5-3-6-11(16)9-10)21-13(23-14)15(17,18)19/h3,5-6,9H,4,7-8H2,1-2H3,(H,20,21,22,23) |
| InChIKey | JKUUVAWKHGOHJC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|