C19H25Cl3N6 — CID 118250454
4-N-phenyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 118250454) has the molecular formula C19H25Cl3N6 and a molecular weight of 443.81 g/mol. Its IUPAC name is 4-N-phenyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-phenyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 118250454 |
| Molecular Formula | C19H25Cl3N6 |
| Molecular Weight | 443.81 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-N-phenyl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(Nc3ccccc3)nc(C(Cl)(Cl)Cl)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H25Cl3N6/c1-17(2)10-13(11-18(3,4)28-17)24-16-26-14(19(20,21)22)25-15(27-16)23-12-8-6-5-7-9-12/h5-9,13,28H,10-11H2,1-4H3,(H2,23,24,25,26,27) |
| InChIKey | SATPIEPJLUVUHY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|