C23H30N6O2 — CID 118251129
3-[cyclopropylmethyl-[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrazin-2-yl-1H-pyridin-2-one (PubChem CID 118251129) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-[cyclopropylmethyl-[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrazin-2-yl-1H-pyridin-2-one.
| Compound Name | 3-[cyclopropylmethyl-[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrazin-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251129 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-[cyclopropylmethyl-[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrazin-2-yl-1H-pyridin-2-one |
| SMILES | CC(C)NC/C=C/C(=O)N1CC(N(CC2CC2)c2cc(-c3cnccn3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C23H30N6O2/c1-16(2)25-7-3-4-22(30)28-14-19(15-28)29(13-17-5-6-17)21-10-18(11-27-23(21)31)20-12-24-8-9-26-20/h3-4,8-12,16-17,19,25H,5-7,13-15H2,1-2H3,(H,27,31)/b4-3+ |
| InChIKey | LHNVNQLEMVXINJ-ONEGZZNKSA-N |
| XLogP | 1.81 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|