C7H7IN2O3 — CID 118251524
(5-iodo-2-methoxy-3-pyridinyl)carbamic acid (PubChem CID 118251524) has the molecular formula C7H7IN2O3 and a molecular weight of 294.05 g/mol. Its IUPAC name is (5-iodo-2-methoxy-3-pyridinyl)carbamic acid.
| Compound Name | (5-iodo-2-methoxy-3-pyridinyl)carbamic acid |
|---|---|
| PubChem CID | 118251524 |
| Molecular Formula | C7H7IN2O3 |
| Molecular Weight | 294.05 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | (5-iodo-2-methoxy-3-pyridinyl)carbamic acid |
| SMILES | COc1ncc(I)cc1NC(=O)O |
| InChI | InChI=1S/C7H7IN2O3/c1-13-6-5(10-7(11)12)2-4(8)3-9-6/h2-3,10H,1H3,(H,11,12) |
| InChIKey | HUMWMNZOOFLSCY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.05 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|