About 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid
9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 118251711) has the molecular formula C17H17NO4
and a molecular weight of 299.33 g/mol. Its IUPAC name is 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
Molecular Properties
| Compound Name | 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| PubChem CID | 118251711 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COc1cc2c(cc1C)-c1cc(=O)c(C(=O)O)cn1C(C)C2 |
| InChI | InChI=1S/C17H17NO4/c1-9-4-12-11(6-16(9)22-3)5-10(2)18-8-13(17(20)21)15(19)7-14(12)18/h4,6-8,10H,5H2,1-3H3,(H,20,21) |
| InChIKey | GSMYJBGXJUIVBN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid?
The IUPAC name of 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (CID 118251711) is 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
What is the SMILES notation for 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid?
The canonical SMILES for 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid is COc1cc2c(cc1C)-c1cc(=O)c(C(=O)O)cn1C(C)C2.
What is the InChIKey of 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid?
The InChIKey is GSMYJBGXJUIVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4/c1-9-4-12-11(6-16(9)22-3)5-10(2)18-8-13(17(20)21)15(19)7-14(12)18/h4,6-8,10H,5H2,1-3H3,(H,20,21).
What are the key properties of 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid?
9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid has a molecular weight of 299.33 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-6,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid is sourced from PubChem (CID 118251711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).