C17H18BrNO3 — CID 118251764
ethyl 11-bromo-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118251764) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is ethyl 11-bromo-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 11-bromo-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118251764 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | ethyl 11-bromo-6-methyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(C)Cc3cccc(Br)c3C2CC1=O |
| InChI | InChI=1S/C17H18BrNO3/c1-3-22-17(21)12-9-19-10(2)7-11-5-4-6-13(18)16(11)14(19)8-15(12)20/h4-6,9-10,14H,3,7-8H2,1-2H3 |
| InChIKey | PFLVZAUPTGOKKV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|