About ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate
ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118252105) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| PubChem CID | 118252105 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(C)c(C)cc1CC2CC |
| InChI | InChI=1S/C20H23NO3/c1-5-15-9-14-7-12(3)13(4)8-16(14)18-10-19(22)17(11-21(15)18)20(23)24-6-2/h7-8,10-11,15H,5-6,9H2,1-4H3 |
| InChIKey | KOKPXNBGXQRLTL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate?
The IUPAC name of ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (CID 118252105) is ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
What is the SMILES notation for ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate?
The canonical SMILES for ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate is CCOC(=O)c1cn2c(cc1=O)-c1cc(C)c(C)cc1CC2CC.
What is the InChIKey of ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate?
The InChIKey is KOKPXNBGXQRLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-5-15-9-14-7-12(3)13(4)8-16(14)18-10-19(22)17(11-21(15)18)20(23)24-6-2/h7-8,10-11,15H,5-6,9H2,1-4H3.
What are the key properties of ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate?
ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate has a molecular weight of 325.41 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethyl-9,10-dimethyl-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate is sourced from PubChem (CID 118252105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).