C23H22N4O2 — CID 11825216
12-benzyl-4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 11825216) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 12-benzyl-4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 12-benzyl-4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 11825216 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 12-benzyl-4-(4-methoxyphenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | COc1ccc(-c2cn3c(=O)[nH]c4c(c3n2)CN(Cc2ccccc2)CC4)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-29-18-9-7-17(8-10-18)21-15-27-22(24-21)19-14-26(12-11-20(19)25-23(27)28)13-16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H,25,28) |
| InChIKey | BSEOVPIAKAXQST-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |