C20H34O7 — CID 11825217
(2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienal (PubChem CID 11825217) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienal.
| Compound Name | (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienal |
|---|---|
| PubChem CID | 11825217 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienal |
| SMILES | COCO[C@@H]([C@H](CC(C)(C)/C=C/C=C/C=O)OCOC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H34O7/c1-19(2,10-8-7-9-11-21)12-16(24-14-22-5)18(25-15-23-6)17-13-26-20(3,4)27-17/h7-11,16-18H,12-15H2,1-6H3/b9-7+,10-8+/t16-,17+,18-/m0/s1 |
| InChIKey | PCSBLFWHJRZVNC-CCJLRUKKSA-N |
| XLogP | 2.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|