C24H34O4 — CID 11825223
[(2R,3E,5E,7E,9E)-2-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trienyl] acetate (PubChem CID 11825223) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [(2R,3E,5E,7E,9E)-2-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trienyl] acetate.
| Compound Name | [(2R,3E,5E,7E,9E)-2-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trienyl] acetate |
|---|---|
| PubChem CID | 11825223 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(2R,3E,5E,7E,9E)-2-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-ylidene)nona-3,5,7-trienyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)/C(C)=C/C=C/C(C)=C/C=C1/C(C)=CCCC1(C)C |
| InChI | InChI=1S/C24H34O4/c1-17(13-14-22-18(2)12-9-15-24(22,6)7)10-8-11-19(3)23(28-21(5)26)16-27-20(4)25/h8,10-14,23H,9,15-16H2,1-7H3/b10-8+,17-13+,19-11+,22-14-/t23-/m0/s1 |
| InChIKey | GSYWHOTZZHYJSA-LKNWFIBVSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|