C28H36N4O3 — CID 118252520
(1S)-2-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 118252520) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is (1S)-2-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | (1S)-2-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 118252520 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (1S)-2-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1Cc2ccccc2[C@H]1C(=O)Nc1cccc2c1CCCC2)C(C)C |
| InChI | InChI=1S/C28H36N4O3/c1-17(2)24(31-26(33)18(3)29-4)28(35)32-16-20-11-6-8-14-22(20)25(32)27(34)30-23-15-9-12-19-10-5-7-13-21(19)23/h6,8-9,11-12,14-15,17-18,24-25,29H,5,7,10,13,16H2,1-4H3,(H,30,34)(H,31,33)/t18?,24?,25-/m0/s1 |
| InChIKey | NMRBTFZYRNGDEW-VHNLKAGOSA-N |
| XLogP | 3.34 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |