About 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate
2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate (PubChem CID 118252616) has the molecular formula C10H20O7P2
and a molecular weight of 314.21 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate |
| PubChem CID | 118252616 |
| Molecular Formula | C10H20O7P2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate |
| SMILES | C=CC(=C)C.CC(C)=CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H12O7P2.C5H8/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-4-5(2)3/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);4H,1-2H2,3H3 |
| InChIKey | OSMLEAAJYLRQIG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate?
The IUPAC name of 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate (CID 118252616) is 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate.
What is the SMILES notation for 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate?
The canonical SMILES for 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate is C=CC(=C)C.CC(C)=CCOP(=O)(O)OP(=O)(O)O.
What is the InChIKey of 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate?
The InChIKey is OSMLEAAJYLRQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O7P2.C5H8/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-4-5(2)3/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);4H,1-2H2,3H3.
What are the key properties of 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate?
2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate has a molecular weight of 314.21 g/mol, XLogP of 2.93, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;3-methylbut-2-enyl phosphono hydrogen phosphate is sourced from PubChem (CID 118252616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).