C24H19Cl2F4NO3 — CID 118252748
(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-[1'-(2-methylpropanoyl)spiro[3H-2-benzofuran-1,3'-azetidine]-5-yl]but-2-en-1-one (PubChem CID 118252748) has the molecular formula C24H19Cl2F4NO3 and a molecular weight of 516.32 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-[1'-(2-methylpropanoyl)spiro[3H-2-benzofuran-1,3'-azetidine]-5-yl]but-2-en-1-one.
| Compound Name | (E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-[1'-(2-methylpropanoyl)spiro[3H-2-benzofuran-1,3'-azetidine]-5-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118252748 |
| Molecular Formula | C24H19Cl2F4NO3 |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | (E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-[1'-(2-methylpropanoyl)spiro[3H-2-benzofuran-1,3'-azetidine]-5-yl]but-2-en-1-one |
| SMILES | CC(C)C(=O)N1CC2(C1)OCc1cc(C(=O)/C=C(\c3cc(Cl)c(F)c(Cl)c3)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H19Cl2F4NO3/c1-12(2)22(33)31-10-23(11-31)16-4-3-13(5-15(16)9-34-23)20(32)8-17(24(28,29)30)14-6-18(25)21(27)19(26)7-14/h3-8,12H,9-11H2,1-2H3/b17-8+ |
| InChIKey | FFWLVLGVRVPNNS-CAOOACKPSA-N |
| XLogP | 6.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|