About 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide
5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide (PubChem CID 118252767) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide |
| PubChem CID | 118252767 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide |
| SMILES | CN1CCc2occ(C(=O)Nc3ccc4nn(C)cc4c3)c2C1=O |
| InChI | InChI=1S/C17H16N4O3/c1-20-6-5-14-15(17(20)23)12(9-24-14)16(22)18-11-3-4-13-10(7-11)8-21(2)19-13/h3-4,7-9H,5-6H2,1-2H3,(H,18,22) |
| InChIKey | LRIXPAKXRLDUKW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide?
The IUPAC name of 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide (CID 118252767) is 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide.
What is the SMILES notation for 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide?
The canonical SMILES for 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide is CN1CCc2occ(C(=O)Nc3ccc4nn(C)cc4c3)c2C1=O.
What is the InChIKey of 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide?
The InChIKey is LRIXPAKXRLDUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c1-20-6-5-14-15(17(20)23)12(9-24-14)16(22)18-11-3-4-13-10(7-11)8-21(2)19-13/h3-4,7-9H,5-6H2,1-2H3,(H,18,22).
What are the key properties of 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide?
5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide has a molecular weight of 324.34 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2-methylindazol-5-yl)-4-oxo-6,7-dihydrofuro[3,2-c]pyridine-3-carboxamide is sourced from PubChem (CID 118252767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).