C21H44O4Si — CID 11825278
ethyl (2R,3S)-2-hydroxy-3-tri(propan-2-yl)silyloxydecanoate (PubChem CID 11825278) has the molecular formula C21H44O4Si and a molecular weight of 388.67 g/mol. Its IUPAC name is ethyl (2R,3S)-2-hydroxy-3-tri(propan-2-yl)silyloxydecanoate.
| Compound Name | ethyl (2R,3S)-2-hydroxy-3-tri(propan-2-yl)silyloxydecanoate |
|---|---|
| PubChem CID | 11825278 |
| Molecular Formula | C21H44O4Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | ethyl (2R,3S)-2-hydroxy-3-tri(propan-2-yl)silyloxydecanoate |
| SMILES | CCCCCCC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)C(=O)OCC |
| InChI | InChI=1S/C21H44O4Si/c1-9-11-12-13-14-15-19(20(22)21(23)24-10-2)25-26(16(3)4,17(5)6)18(7)8/h16-20,22H,9-15H2,1-8H3/t19-,20+/m0/s1 |
| InChIKey | DIAIDJQYRCJEAE-VQTJNVASSA-N |
| XLogP | 5.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|