About ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate
ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate (PubChem CID 118252891) has the molecular formula C12H16O6
and a molecular weight of 256.25 g/mol. Its IUPAC name is ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate |
| PubChem CID | 118252891 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate |
| SMILES | CCOC(=O)C1(O)COC2=C1C(=O)COC2(C)C |
| InChI | InChI=1S/C12H16O6/c1-4-16-10(14)12(15)6-17-9-8(12)7(13)5-18-11(9,2)3/h15H,4-6H2,1-3H3 |
| InChIKey | SXDPHHGFECYRDV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate?
The IUPAC name of ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate (CID 118252891) is ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate.
What is the SMILES notation for ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate?
The canonical SMILES for ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate is CCOC(=O)C1(O)COC2=C1C(=O)COC2(C)C.
What is the InChIKey of ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate?
The InChIKey is SXDPHHGFECYRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6/c1-4-16-10(14)12(15)6-17-9-8(12)7(13)5-18-11(9,2)3/h15H,4-6H2,1-3H3.
What are the key properties of ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate?
ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate has a molecular weight of 256.25 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxy-7,7-dimethyl-4-oxo-2H-furo[2,3-c]pyran-3-carboxylate is sourced from PubChem (CID 118252891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).