C18H20ClN3O4 — CID 118252903
N-(6-chloro-2-propan-2-yloxy-3-pyridinyl)-6,6-dimethyl-4-oxo-5,7-dihydrofuro[3,2-c]pyridine-3-carboxamide (PubChem CID 118252903) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is N-(6-chloro-2-propan-2-yloxy-3-pyridinyl)-6,6-dimethyl-4-oxo-5,7-dihydrofuro[3,2-c]pyridine-3-carboxamide.
| Compound Name | N-(6-chloro-2-propan-2-yloxy-3-pyridinyl)-6,6-dimethyl-4-oxo-5,7-dihydrofuro[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118252903 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(6-chloro-2-propan-2-yloxy-3-pyridinyl)-6,6-dimethyl-4-oxo-5,7-dihydrofuro[3,2-c]pyridine-3-carboxamide |
| SMILES | CC(C)Oc1nc(Cl)ccc1NC(=O)c1coc2c1C(=O)NC(C)(C)C2 |
| InChI | InChI=1S/C18H20ClN3O4/c1-9(2)26-17-11(5-6-13(19)21-17)20-15(23)10-8-25-12-7-18(3,4)22-16(24)14(10)12/h5-6,8-9H,7H2,1-4H3,(H,20,23)(H,22,24) |
| InChIKey | VISWMJZTJFRCGD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|