About 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone
1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 118253022) has the molecular formula C13H17F3N4O2
and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone |
| PubChem CID | 118253022 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(N)c(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C13H17F3N4O2/c1-9(21)19-4-6-20(7-5-19)11-3-2-10(17)12(18-11)22-8-13(14,15)16/h2-3H,4-8,17H2,1H3 |
| InChIKey | GKXYJLCORVJJGU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone (CID 118253022) is 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone is CC(=O)N1CCN(c2ccc(N)c(OCC(F)(F)F)n2)CC1.
What is the InChIKey of 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone?
The InChIKey is GKXYJLCORVJJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N4O2/c1-9(21)19-4-6-20(7-5-19)11-3-2-10(17)12(18-11)22-8-13(14,15)16/h2-3H,4-8,17H2,1H3.
What are the key properties of 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone?
1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone has a molecular weight of 318.30 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[5-amino-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperazin-1-yl]ethanone is sourced from PubChem (CID 118253022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).