About CID 11825328
CID 11825328 (PubChem CID 11825328) has the molecular formula C21H21FeNOS+2
and a molecular weight of 391.32 g/mol.
Molecular Properties
| Compound Name | CID 11825328 |
| PubChem CID | 11825328 |
| Molecular Formula | C21H21FeNOS+2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | — |
| SMILES | CC1(C)COC([C]2[CH][CH][CH][C]2Sc2ccccc2)=N1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C16H16NOS.C5H5.Fe/c1-16(2)11-18-15(17-16)13-9-6-10-14(13)19-12-7-4-3-5-8-12;1-2-4-5-3-1;/h3-10H,11H2,1-2H3;1-5H;/q;;+2 |
| InChIKey | HQVBJCGQBSFUMD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11825328 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11825328?
The IUPAC name of CID 11825328 (CID 11825328) is not available.
What is the SMILES notation for CID 11825328?
The canonical SMILES for CID 11825328 is CC1(C)COC([C]2[CH][CH][CH][C]2Sc2ccccc2)=N1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11825328?
The InChIKey is HQVBJCGQBSFUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16NOS.C5H5.Fe/c1-16(2)11-18-15(17-16)13-9-6-10-14(13)19-12-7-4-3-5-8-12;1-2-4-5-3-1;/h3-10H,11H2,1-2H3;1-5H;/q;;+2.
What are the key properties of CID 11825328?
CID 11825328 has a molecular weight of 391.32 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11825328 is sourced from PubChem (CID 11825328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).