About CID 11825329
CID 11825329 (PubChem CID 11825329) has the molecular formula C16H16NOS
and a molecular weight of 270.38 g/mol.
Molecular Properties
| Compound Name | CID 11825329 |
| PubChem CID | 11825329 |
| Molecular Formula | C16H16NOS |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | — |
| SMILES | CC1(C)COC([C]2[CH][CH][CH][C]2Sc2ccccc2)=N1 |
| InChI | InChI=1S/C16H16NOS/c1-16(2)11-18-15(17-16)13-9-6-10-14(13)19-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3 |
| InChIKey | GDIIJRFVIDCEGR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 11825329 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11825329?
The IUPAC name of CID 11825329 (CID 11825329) is not available.
What is the SMILES notation for CID 11825329?
The canonical SMILES for CID 11825329 is CC1(C)COC([C]2[CH][CH][CH][C]2Sc2ccccc2)=N1.
What is the InChIKey of CID 11825329?
The InChIKey is GDIIJRFVIDCEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16NOS/c1-16(2)11-18-15(17-16)13-9-6-10-14(13)19-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3.
What are the key properties of CID 11825329?
CID 11825329 has a molecular weight of 270.38 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11825329 is sourced from PubChem (CID 11825329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).