C29H40F4O5S2 — CID 118253797
[4-[4-(4-tert-butylphenyl)butylsulfanyloxysulfonyl]-3,3,4,4-tetrafluorobutyl] adamantane-1-carboxylate (PubChem CID 118253797) has the molecular formula C29H40F4O5S2 and a molecular weight of 608.76 g/mol. Its IUPAC name is [4-[4-(4-tert-butylphenyl)butylsulfanyloxysulfonyl]-3,3,4,4-tetrafluorobutyl] adamantane-1-carboxylate.
| Compound Name | [4-[4-(4-tert-butylphenyl)butylsulfanyloxysulfonyl]-3,3,4,4-tetrafluorobutyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 118253797 |
| Molecular Formula | C29H40F4O5S2 |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | [4-[4-(4-tert-butylphenyl)butylsulfanyloxysulfonyl]-3,3,4,4-tetrafluorobutyl] adamantane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc(CCCCSOS(=O)(=O)C(F)(F)C(F)(F)CCOC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H40F4O5S2/c1-26(2,3)24-9-7-20(8-10-24)6-4-5-13-39-38-40(35,36)29(32,33)28(30,31)11-12-37-25(34)27-17-21-14-22(18-27)16-23(15-21)19-27/h7-10,21-23H,4-6,11-19H2,1-3H3 |
| InChIKey | WLAPHKDMSHMIAU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|