C25H22ClNO5 — CID 118254146
(2S,5'S,7'R)-7-chloro-5'-hydroxy-4,6-dimethoxy-7'-methyl-2'-phenylspiro[1-benzofuran-2,8'-6,7-dihydro-5H-quinoline]-3-one (PubChem CID 118254146) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is (2S,5'S,7'R)-7-chloro-5'-hydroxy-4,6-dimethoxy-7'-methyl-2'-phenylspiro[1-benzofuran-2,8'-6,7-dihydro-5H-quinoline]-3-one.
| Compound Name | (2S,5'S,7'R)-7-chloro-5'-hydroxy-4,6-dimethoxy-7'-methyl-2'-phenylspiro[1-benzofuran-2,8'-6,7-dihydro-5H-quinoline]-3-one |
|---|---|
| PubChem CID | 118254146 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (2S,5'S,7'R)-7-chloro-5'-hydroxy-4,6-dimethoxy-7'-methyl-2'-phenylspiro[1-benzofuran-2,8'-6,7-dihydro-5H-quinoline]-3-one |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)c2nc(-c3ccccc3)ccc2[C@@H](O)C[C@H]1C |
| InChI | InChI=1S/C25H22ClNO5/c1-13-11-17(28)15-9-10-16(14-7-5-4-6-8-14)27-23(15)25(13)24(29)20-18(30-2)12-19(31-3)21(26)22(20)32-25/h4-10,12-13,17,28H,11H2,1-3H3/t13-,17+,25+/m1/s1 |
| InChIKey | UMJKEMBQRFQEIA-ISWKSCHSSA-N |
| XLogP | 4.96 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |