About 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine
3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine (PubChem CID 118254316) has the molecular formula C10H12IN3
and a molecular weight of 301.13 g/mol. Its IUPAC name is 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine |
| PubChem CID | 118254316 |
| Molecular Formula | C10H12IN3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine |
| SMILES | CC(C)Nc1cnc2[nH]cc(I)c2c1 |
| InChI | InChI=1S/C10H12IN3/c1-6(2)14-7-3-8-9(11)5-13-10(8)12-4-7/h3-6,14H,1-2H3,(H,12,13) |
| InChIKey | ZOBZHXDODAUCAD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine?
The IUPAC name of 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine (CID 118254316) is 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine.
What is the SMILES notation for 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine?
The canonical SMILES for 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine is CC(C)Nc1cnc2[nH]cc(I)c2c1.
What is the InChIKey of 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine?
The InChIKey is ZOBZHXDODAUCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12IN3/c1-6(2)14-7-3-8-9(11)5-13-10(8)12-4-7/h3-6,14H,1-2H3,(H,12,13).
What are the key properties of 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine?
3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine has a molecular weight of 301.13 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-N-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-amine is sourced from PubChem (CID 118254316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).