C23H29NO5 — CID 11825511
benzyl (2S)-2-[[(2S,3S)-2,3-dihydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate (PubChem CID 11825511) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S,3S)-2,3-dihydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2S,3S)-2,3-dihydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11825511 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | benzyl (2S)-2-[[(2S,3S)-2,3-dihydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@@H](O)Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c1-16(2)13-19(23(28)29-15-18-11-7-4-8-12-18)24-22(27)21(26)20(25)14-17-9-5-3-6-10-17/h3-12,16,19-21,25-26H,13-15H2,1-2H3,(H,24,27)/t19-,20-,21-/m0/s1 |
| InChIKey | GAHAKROKGOZZGD-ACRUOGEOSA-N |
| XLogP | 2.23 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |