About 2,3-difluoro-1,1-dimethylcyclohexane
2,3-difluoro-1,1-dimethylcyclohexane (PubChem CID 118255177) has the molecular formula C8H14F2
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2,3-difluoro-1,1-dimethylcyclohexane.
Molecular Properties
| Compound Name | 2,3-difluoro-1,1-dimethylcyclohexane |
| PubChem CID | 118255177 |
| Molecular Formula | C8H14F2 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 2,3-difluoro-1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCCC(F)C1F |
| InChI | InChI=1S/C8H14F2/c1-8(2)5-3-4-6(9)7(8)10/h6-7H,3-5H2,1-2H3 |
| InChIKey | TUIFHEFAYMFTKO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-difluoro-1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-1,1-dimethylcyclohexane?
The IUPAC name of 2,3-difluoro-1,1-dimethylcyclohexane (CID 118255177) is 2,3-difluoro-1,1-dimethylcyclohexane.
What is the SMILES notation for 2,3-difluoro-1,1-dimethylcyclohexane?
The canonical SMILES for 2,3-difluoro-1,1-dimethylcyclohexane is CC1(C)CCCC(F)C1F.
What is the InChIKey of 2,3-difluoro-1,1-dimethylcyclohexane?
The InChIKey is TUIFHEFAYMFTKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2/c1-8(2)5-3-4-6(9)7(8)10/h6-7H,3-5H2,1-2H3.
What are the key properties of 2,3-difluoro-1,1-dimethylcyclohexane?
2,3-difluoro-1,1-dimethylcyclohexane has a molecular weight of 148.20 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-1,1-dimethylcyclohexane is sourced from PubChem (CID 118255177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).