C18H33Cl2N3 — CID 118255375
(2R)-2-amino-4-(4-octylphenyl)butanimidamide;dihydrochloride (PubChem CID 118255375) has the molecular formula C18H33Cl2N3 and a molecular weight of 362.39 g/mol. Its IUPAC name is (2R)-2-amino-4-(4-octylphenyl)butanimidamide;dihydrochloride.
| Compound Name | (2R)-2-amino-4-(4-octylphenyl)butanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 118255375 |
| Molecular Formula | C18H33Cl2N3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | (2R)-2-amino-4-(4-octylphenyl)butanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)[C@H](N)CCc1ccc(CCCCCCCC)cc1 |
| InChI | InChI=1S/C18H31N3.2ClH/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)13-14-17(19)18(20)21;;/h9-12,17H,2-8,13-14,19H2,1H3,(H3,20,21);2*1H/t17-;;/m1../s1 |
| InChIKey | NVCUBWILORDZJJ-ZEECNFPPSA-N |
| XLogP | 4.63 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|