C20H40O4Si2 — CID 11825549
(4R,5S,6R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-1-trimethylsilyloct-7-en-1-yn-4-ol (PubChem CID 11825549) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is (4R,5S,6R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-1-trimethylsilyloct-7-en-1-yn-4-ol.
| Compound Name | (4R,5S,6R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-1-trimethylsilyloct-7-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11825549 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (4R,5S,6R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-1-trimethylsilyloct-7-en-1-yn-4-ol |
| SMILES | C=C[C@@H](OCOC)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-11-19(23-16-22-5)17(15-24-26(9,10)20(2,3)4)18(21)13-12-14-25(6,7)8/h11,17-19,21H,1,13,15-16H2,2-10H3/t17-,18+,19+/m0/s1 |
| InChIKey | HBUOWDVWIJGIIN-IPMKNSEASA-N |
| XLogP | 4.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|