C20H40O4Si2 — CID 11825550
methyl (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexene-1-carboxylate (PubChem CID 11825550) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is methyl (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexene-1-carboxylate.
| Compound Name | methyl (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11825550 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | methyl (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-19(2,3)25(8,9)23-15-12-13-16(18(21)22-7)17(14-15)24-26(10,11)20(4,5)6/h13,15,17H,12,14H2,1-11H3/t15-,17+/m1/s1 |
| InChIKey | NXGZXWAGUBICSE-WBVHZDCISA-N |
| XLogP | 5.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|