C33H40F3N4O3- — CID 118255943
3-[ethyl(oxan-4-yl)amino]-2-methyl-N-[(4-methyl-2-oxido-3,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-1-yl)methyl]-5-[6-(trifluoromethyl)-3-pyridinyl]benzamide (PubChem CID 118255943) has the molecular formula C33H40F3N4O3- and a molecular weight of 597.70 g/mol. Its IUPAC name is 3-[ethyl(oxan-4-yl)amino]-2-methyl-N-[(4-methyl-2-oxido-3,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-1-yl)methyl]-5-[6-(trifluoromethyl)-3-pyridinyl]benzamide.
| Compound Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-N-[(4-methyl-2-oxido-3,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-1-yl)methyl]-5-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 118255943 |
| Molecular Formula | C33H40F3N4O3- |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-N-[(4-methyl-2-oxido-3,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-1-yl)methyl]-5-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
| SMILES | CCN(c1cc(-c2ccc(C(F)(F)F)nc2)cc(C(=O)NCC2=C3CCCCCC3=C(C)CN2[O-])c1C)C1CCOCC1 |
| InChI | InChI=1S/C33H40F3N4O3/c1-4-39(25-12-14-43-15-13-25)29-17-24(23-10-11-31(37-18-23)33(34,35)36)16-28(22(29)3)32(41)38-19-30-27-9-7-5-6-8-26(27)21(2)20-40(30)42/h10-11,16-18,25H,4-9,12-15,19-20H2,1-3H3,(H,38,41)/q-1 |
| InChIKey | LIAKFEQBUOCLOR-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |