About 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole
2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole (PubChem CID 11825610) has the molecular formula C23H19BrN2
and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole |
| PubChem CID | 11825610 |
| Molecular Formula | C23H19BrN2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole |
| SMILES | CCn1c(-c2ccc(Br)cc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H19BrN2/c1-2-26-22(18-11-7-4-8-12-18)21(17-9-5-3-6-10-17)25-23(26)19-13-15-20(24)16-14-19/h3-16H,2H2,1H3 |
| InChIKey | QRDUASNYLWIPED-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole?
The IUPAC name of 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole (CID 11825610) is 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole.
What is the SMILES notation for 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole?
The canonical SMILES for 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole is CCn1c(-c2ccc(Br)cc2)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole?
The InChIKey is QRDUASNYLWIPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19BrN2/c1-2-26-22(18-11-7-4-8-12-18)21(17-9-5-3-6-10-17)25-23(26)19-13-15-20(24)16-14-19/h3-16H,2H2,1H3.
What are the key properties of 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole?
2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole has a molecular weight of 403.32 g/mol, XLogP of 6.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1-ethyl-4,5-diphenylimidazole is sourced from PubChem (CID 11825610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).