C17H29F5N4O4 — CID 118256147
tert-butyl piperazine-1-carboxylate;4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylic acid (PubChem CID 118256147) has the molecular formula C17H29F5N4O4 and a molecular weight of 448.43 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylic acid.
| Compound Name | tert-butyl piperazine-1-carboxylate;4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 118256147 |
| Molecular Formula | C17H29F5N4O4 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.O=C(O)N1CCN(CC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H18N2O2.C8H11F5N2O2/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;9-7(10,8(11,12)13)5-14-1-3-15(4-2-14)6(16)17/h10H,4-7H2,1-3H3;1-5H2,(H,16,17) |
| InChIKey | GQKNZRGHXJLGDQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|