C17H14ClFN4O3 — CID 118256660
5-chloro-6-fluoro-3-methyl-2,10-dioxa-13,17,18,21-tetrazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one (PubChem CID 118256660) has the molecular formula C17H14ClFN4O3 and a molecular weight of 376.78 g/mol. Its IUPAC name is 5-chloro-6-fluoro-3-methyl-2,10-dioxa-13,17,18,21-tetrazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one.
| Compound Name | 5-chloro-6-fluoro-3-methyl-2,10-dioxa-13,17,18,21-tetrazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one |
|---|---|
| PubChem CID | 118256660 |
| Molecular Formula | C17H14ClFN4O3 |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 5-chloro-6-fluoro-3-methyl-2,10-dioxa-13,17,18,21-tetrazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one |
| SMILES | CC1Oc2ccn3ncc(c3n2)C(=O)NCCOc2ccc(F)c(Cl)c21 |
| InChI | InChI=1S/C17H14ClFN4O3/c1-9-14-12(3-2-11(19)15(14)18)25-7-5-20-17(24)10-8-21-23-6-4-13(26-9)22-16(10)23/h2-4,6,8-9H,5,7H2,1H3,(H,20,24) |
| InChIKey | YMRTYJKGNCAGKP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |