C31H36BrNO3 — CID 118256682
2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;bromomethylbenzene (PubChem CID 118256682) has the molecular formula C31H36BrNO3 and a molecular weight of 550.54 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;bromomethylbenzene.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;bromomethylbenzene |
|---|---|
| PubChem CID | 118256682 |
| Molecular Formula | C31H36BrNO3 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;bromomethylbenzene |
| SMILES | BrCc1ccccc1.COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccccc3)CC1)C2 |
| InChI | InChI=1S/C24H29NO3.C7H7Br/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18;8-6-7-4-2-1-3-5-7/h3-7,14-15,17,20H,8-13,16H2,1-2H3;1-5H,6H2 |
| InChIKey | AXONCFCBKCUXRI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|