About 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide
3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 118256906) has the molecular formula C15H10F3N7O2S
and a molecular weight of 409.35 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 118256906 |
| Molecular Formula | C15H10F3N7O2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(C(F)(F)F)ccc(-c2ccc3nccn3c2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C15H10F3N7O2S/c16-15(17,18)10-3-2-9(8-1-4-11-20-5-6-25(11)7-8)12(13(10)28(19,26)27)14-21-23-24-22-14/h1-7H,(H2,19,26,27)(H,21,22,23,24) |
| InChIKey | PFRNSTVHCRBTSN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide (CID 118256906) is 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide is NS(=O)(=O)c1c(C(F)(F)F)ccc(-c2ccc3nccn3c2)c1-c1nn[nH]n1.
What is the InChIKey of 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide?
The InChIKey is PFRNSTVHCRBTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N7O2S/c16-15(17,18)10-3-2-9(8-1-4-11-20-5-6-25(11)7-8)12(13(10)28(19,26)27)14-21-23-24-22-14/h1-7H,(H2,19,26,27)(H,21,22,23,24).
What are the key properties of 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide?
3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide has a molecular weight of 409.35 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyridin-6-yl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 118256906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).