C14H16F3N5O2S — CID 118257032
N-cyclohexyl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 118257032) has the molecular formula C14H16F3N5O2S and a molecular weight of 375.38 g/mol. Its IUPAC name is N-cyclohexyl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-cyclohexyl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118257032 |
| Molecular Formula | C14H16F3N5O2S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-cyclohexyl-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1)c1c(-c2nn[nH]n2)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N5O2S/c15-14(16,17)11-8-4-7-10(13-18-21-22-19-13)12(11)25(23,24)20-9-5-2-1-3-6-9/h4,7-9,20H,1-3,5-6H2,(H,18,19,21,22) |
| InChIKey | ZHSDWTXGWUGFDP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |