C32H29F3N6O5S — CID 118257265
methyl 4-[3-[(4-methoxyphenyl)methylsulfamoyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]benzenecarboximidate (PubChem CID 118257265) has the molecular formula C32H29F3N6O5S and a molecular weight of 666.68 g/mol. Its IUPAC name is methyl 4-[3-[(4-methoxyphenyl)methylsulfamoyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]benzenecarboximidate.
| Compound Name | methyl 4-[3-[(4-methoxyphenyl)methylsulfamoyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 118257265 |
| Molecular Formula | C32H29F3N6O5S |
| Molecular Weight | 666.68 g/mol |
| Exact Mass | 666.19 |
| IUPAC Name | methyl 4-[3-[(4-methoxyphenyl)methylsulfamoyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OC)c1ccc(-c2ccc(C(F)(F)F)c(S(=O)(=O)NCc3ccc(OC)cc3)c2-c2nnnn2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H29F3N6O5S/c1-44-24-12-4-20(5-13-24)18-37-47(42,43)29-27(32(33,34)35)17-16-26(22-8-10-23(11-9-22)30(36)46-3)28(29)31-38-39-40-41(31)19-21-6-14-25(45-2)15-7-21/h4-17,36-37H,18-19H2,1-3H3/b36-30- |
| InChIKey | JBZCFEUSTGZDAS-BBTNWVSFSA-N |
| XLogP | 5.54 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|