C40H35F3N8O5S2 — CID 118257271
4-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]-1,3-benzothiazole-2-carboximidamide (PubChem CID 118257271) has the molecular formula C40H35F3N8O5S2 and a molecular weight of 828.90 g/mol. Its IUPAC name is 4-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]-1,3-benzothiazole-2-carboximidamide.
| Compound Name | 4-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 118257271 |
| Molecular Formula | C40H35F3N8O5S2 |
| Molecular Weight | 828.90 g/mol |
| Exact Mass | 828.21 |
| IUPAC Name | 4-[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-4-(trifluoromethyl)phenyl]-1,3-benzothiazole-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc2c(-c3ccc(C(F)(F)F)c(S(=O)(=O)N(Cc4ccc(OC)cc4)Cc4ccc(OC)cc4)c3-c3nnn(Cc4ccc(OC)cc4)n3)cccc2s1 |
| InChI | InChI=1S/C40H35F3N8O5S2/c1-54-27-13-7-24(8-14-27)21-50(22-25-9-15-28(55-2)16-10-25)58(52,53)36-32(40(41,42)43)20-19-30(31-5-4-6-33-35(31)46-39(57-33)37(44)45)34(36)38-47-49-51(48-38)23-26-11-17-29(56-3)18-12-26/h4-20H,21-23H2,1-3H3,(H3,44,45) |
| InChIKey | TUTSTEZGCLRYAI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 171.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.90 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|