About 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide
3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 118257351) has the molecular formula C14H11N7O2S
and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| PubChem CID | 118257351 |
| Molecular Formula | C14H11N7O2S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2ccn3cncc3c2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C14H11N7O2S/c15-24(22,23)12-3-1-2-11(13(12)14-17-19-20-18-14)9-4-5-21-8-16-7-10(21)6-9/h1-8H,(H2,15,22,23)(H,17,18,19,20) |
| InChIKey | HRQLQDRPKAITER-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide?
The IUPAC name of 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide (CID 118257351) is 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide?
The canonical SMILES for 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide is NS(=O)(=O)c1cccc(-c2ccn3cncc3c2)c1-c1nn[nH]n1.
What is the InChIKey of 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide?
The InChIKey is HRQLQDRPKAITER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N7O2S/c15-24(22,23)12-3-1-2-11(13(12)14-17-19-20-18-14)9-4-5-21-8-16-7-10(21)6-9/h1-8H,(H2,15,22,23)(H,17,18,19,20).
What are the key properties of 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide?
3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide has a molecular weight of 341.36 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,5-a]pyridin-7-yl-2-(2H-tetrazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 118257351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).